winit-sonoma-fix/src/window.rs

942 lines
31 KiB
Rust
Raw Normal View History

Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
//! The `Window` struct and associated types.
use std::fmt;
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
use crate::{
dpi::{PhysicalPosition, PhysicalSize, Position, Size},
error::{ExternalError, NotSupportedError, OsError},
event_loop::EventLoopWindowTarget,
monitor::{MonitorHandle, VideoMode},
platform_impl,
};
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
pub use crate::icon::{BadIcon, Icon};
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
/// Represents a window.
///
/// # Example
///
/// ```no_run
/// use winit::{
/// event::{Event, WindowEvent},
/// event_loop::{ControlFlow, EventLoop},
/// window::Window,
/// };
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
///
/// let mut event_loop = EventLoop::new();
/// let window = Window::new(&event_loop).unwrap();
///
/// event_loop.run(move |event, _, control_flow| {
/// *control_flow = ControlFlow::Wait;
///
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
/// match event {
/// Event::WindowEvent {
/// event: WindowEvent::CloseRequested,
/// ..
/// } => *control_flow = ControlFlow::Exit,
/// _ => (),
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
/// }
/// });
/// ```
pub struct Window {
pub(crate) window: platform_impl::Window,
}
impl fmt::Debug for Window {
fn fmt(&self, fmtr: &mut fmt::Formatter<'_>) -> fmt::Result {
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
fmtr.pad("Window { .. }")
}
}
Add exclusive fullscreen mode (#925) * Add exclusive fullscreen mode * Add `WindowExtMacOS::set_fullscreen_presentation_options` * Capture display for exclusive fullscreen on macOS * Fix applying video mode on macOS after a fullscreen cycle * Fix compilation on iOS * Set monitor appropriately for fullscreen on macOS * Fix exclusive to borderless fullscreen transitions on macOS * Fix borderless to exclusive fullscreen transition on macOS * Sort video modes on Windows * Fix fullscreen issues on Windows * Fix video mode changes during exclusive fullscreen on Windows * Add video mode sorting for macOS and iOS * Fix monitor `ns_screen` returning `None` after video mode change * Fix "multithreaded" example on macOS * Restore video mode upon closing an exclusive fullscreen window * Fix "multithreaded" example closing multiple windows at once * Fix compilation on Linux * Update FEATURES.md * Don't care about logical monitor groups on X11 * Add exclusive fullscreen for X11 * Update FEATURES.md * Fix transitions between exclusive and borderless fullscreen on X11 * Update CHANGELOG.md * Document that Wayland doesn't support exclusive fullscreen * Replace core-graphics display mode bindings on macOS * Use `panic!()` instead of `unreachable!()` in "fullscreen" example * Fix fullscreen "always on top" flag on Windows * Track current monitor for fullscreen in "multithreaded" example * Fix exclusive fullscreen sometimes not positioning window properly * Format * More formatting and fix CI issues * Fix formatting * Fix changelog formatting
2019-07-30 04:16:14 +10:00
impl Drop for Window {
fn drop(&mut self) {
// If the window is in exclusive fullscreen, we must restore the desktop
// video mode (generally this would be done on application exit, but
// closing the window doesn't necessarily always mean application exit,
// such as when there are multiple windows)
if let Some(Fullscreen::Exclusive(_)) = self.fullscreen() {
self.set_fullscreen(None);
}
}
}
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
/// Identifier of a window. Unique for each window.
///
/// Can be obtained with `window.id()`.
///
/// Whenever you receive an event specific to a window, this event contains a `WindowId` which you
/// can then compare to the ids of your windows.
#[derive(Debug, Copy, Clone, PartialEq, Eq, PartialOrd, Ord, Hash)]
pub struct WindowId(pub(crate) platform_impl::WindowId);
impl WindowId {
/// Returns a dummy `WindowId`, useful for unit testing. The only guarantee made about the return
/// value of this function is that it will always be equal to itself and to future values returned
/// by this function. No other guarantees are made. This may be equal to a real `WindowId`.
///
/// **Passing this into a winit function will result in undefined behavior.**
pub unsafe fn dummy() -> Self {
WindowId(platform_impl::WindowId::dummy())
}
}
/// Object that allows you to build windows.
2020-01-08 06:33:56 +11:00
#[derive(Clone, Default)]
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
pub struct WindowBuilder {
/// The attributes to use to create the window.
pub window: WindowAttributes,
// Platform-specific configuration.
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
pub(crate) platform_specific: platform_impl::PlatformSpecificWindowBuilderAttributes,
}
impl fmt::Debug for WindowBuilder {
fn fmt(&self, fmtr: &mut fmt::Formatter<'_>) -> fmt::Result {
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
fmtr.debug_struct("WindowBuilder")
.field("window", &self.window)
.finish()
}
}
/// Attributes to use when creating a window.
#[derive(Debug, Clone)]
pub struct WindowAttributes {
/// The dimensions of the window. If this is `None`, some platform-specific dimensions will be
/// used.
///
/// The default is `None`.
pub inner_size: Option<Size>,
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
/// The minimum dimensions a window can be, If this is `None`, the window will have no minimum dimensions (aside from reserved).
///
/// The default is `None`.
pub min_inner_size: Option<Size>,
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
/// The maximum dimensions a window can be, If this is `None`, the maximum will have no maximum or will be set to the primary monitor's dimensions by the platform.
///
/// The default is `None`.
pub max_inner_size: Option<Size>,
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
/// Whether the window is resizable or not.
///
/// The default is `true`.
pub resizable: bool,
/// Whether the window should be set as fullscreen upon creation.
///
/// The default is `None`.
Add exclusive fullscreen mode (#925) * Add exclusive fullscreen mode * Add `WindowExtMacOS::set_fullscreen_presentation_options` * Capture display for exclusive fullscreen on macOS * Fix applying video mode on macOS after a fullscreen cycle * Fix compilation on iOS * Set monitor appropriately for fullscreen on macOS * Fix exclusive to borderless fullscreen transitions on macOS * Fix borderless to exclusive fullscreen transition on macOS * Sort video modes on Windows * Fix fullscreen issues on Windows * Fix video mode changes during exclusive fullscreen on Windows * Add video mode sorting for macOS and iOS * Fix monitor `ns_screen` returning `None` after video mode change * Fix "multithreaded" example on macOS * Restore video mode upon closing an exclusive fullscreen window * Fix "multithreaded" example closing multiple windows at once * Fix compilation on Linux * Update FEATURES.md * Don't care about logical monitor groups on X11 * Add exclusive fullscreen for X11 * Update FEATURES.md * Fix transitions between exclusive and borderless fullscreen on X11 * Update CHANGELOG.md * Document that Wayland doesn't support exclusive fullscreen * Replace core-graphics display mode bindings on macOS * Use `panic!()` instead of `unreachable!()` in "fullscreen" example * Fix fullscreen "always on top" flag on Windows * Track current monitor for fullscreen in "multithreaded" example * Fix exclusive fullscreen sometimes not positioning window properly * Format * More formatting and fix CI issues * Fix formatting * Fix changelog formatting
2019-07-30 04:16:14 +10:00
pub fullscreen: Option<Fullscreen>,
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
/// The title of the window in the title bar.
///
/// The default is `"winit window"`.
pub title: String,
/// Whether the window should be maximized upon creation.
///
/// The default is `false`.
pub maximized: bool,
/// Whether the window should be immediately visible upon creation.
///
/// The default is `true`.
pub visible: bool,
/// Whether the the window should be transparent. If this is true, writing colors
/// with alpha values different than `1.0` will produce a transparent window.
///
/// The default is `false`.
pub transparent: bool,
/// Whether the window should have borders and bars.
///
/// The default is `true`.
pub decorations: bool,
/// Whether the window should always be on top of other windows.
///
/// The default is `false`.
pub always_on_top: bool,
/// The window icon.
///
/// The default is `None`.
pub window_icon: Option<Icon>,
}
impl Default for WindowAttributes {
#[inline]
fn default() -> WindowAttributes {
WindowAttributes {
inner_size: None,
min_inner_size: None,
max_inner_size: None,
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
resizable: true,
title: "winit window".to_owned(),
maximized: false,
fullscreen: None,
visible: true,
transparent: false,
decorations: true,
always_on_top: false,
window_icon: None,
}
}
}
impl WindowBuilder {
/// Initializes a new `WindowBuilder` with default values.
2015-09-21 22:42:05 +10:00
#[inline]
pub fn new() -> Self {
2020-01-08 06:33:56 +11:00
Default::default()
}
/// Requests the window to be of specific dimensions.
///
/// See [`Window::set_inner_size`] for details.
///
/// [`Window::set_inner_size`]: crate::window::Window::set_inner_size
2015-09-21 22:42:05 +10:00
#[inline]
pub fn with_inner_size<S: Into<Size>>(mut self, size: S) -> Self {
self.window.inner_size = Some(size.into());
self
}
2017-06-22 05:10:23 +10:00
/// Sets a minimum dimension size for the window.
///
/// See [`Window::set_min_inner_size`] for details.
///
/// [`Window::set_min_inner_size`]: crate::window::Window::set_min_inner_size
#[inline]
pub fn with_min_inner_size<S: Into<Size>>(mut self, min_size: S) -> Self {
self.window.min_inner_size = Some(min_size.into());
self
}
/// Sets a maximum dimension size for the window.
///
/// See [`Window::set_max_inner_size`] for details.
///
/// [`Window::set_max_inner_size`]: crate::window::Window::set_max_inner_size
#[inline]
pub fn with_max_inner_size<S: Into<Size>>(mut self, max_size: S) -> Self {
self.window.max_inner_size = Some(max_size.into());
self
}
/// Sets whether the window is resizable or not.
///
/// See [`Window::set_resizable`] for details.
///
/// [`Window::set_resizable`]: crate::window::Window::set_resizable
#[inline]
pub fn with_resizable(mut self, resizable: bool) -> Self {
self.window.resizable = resizable;
self
}
/// Requests a specific title for the window.
///
/// See [`Window::set_title`] for details.
///
/// [`Window::set_title`]: crate::window::Window::set_title
2015-09-21 22:42:05 +10:00
#[inline]
pub fn with_title<T: Into<String>>(mut self, title: T) -> Self {
2016-05-08 17:28:42 +10:00
self.window.title = title.into();
self
}
/// Sets the window fullscreen state.
///
/// See [`Window::set_fullscreen`] for details.
///
/// [`Window::set_fullscreen`]: crate::window::Window::set_fullscreen
2015-09-21 22:42:05 +10:00
#[inline]
2020-08-02 09:10:33 +10:00
pub fn with_fullscreen(mut self, fullscreen: Option<Fullscreen>) -> Self {
self.window.fullscreen = fullscreen;
self
}
/// Requests maximized mode.
///
/// See [`Window::set_maximized`] for details.
///
/// [`Window::set_maximized`]: crate::window::Window::set_maximized
#[inline]
pub fn with_maximized(mut self, maximized: bool) -> Self {
self.window.maximized = maximized;
self
}
/// Sets whether the window will be initially hidden or visible.
///
/// See [`Window::set_visible`] for details.
///
/// [`Window::set_visible`]: crate::window::Window::set_visible
2015-09-21 22:42:05 +10:00
#[inline]
pub fn with_visible(mut self, visible: bool) -> Self {
2015-09-21 21:15:43 +10:00
self.window.visible = visible;
self
}
/// Sets whether the background of the window should be transparent.
2015-09-21 22:42:05 +10:00
#[inline]
pub fn with_transparent(mut self, transparent: bool) -> Self {
2015-09-21 21:15:43 +10:00
self.window.transparent = transparent;
self
}
/// Sets whether the window should have a border, a title bar, etc.
///
/// See [`Window::set_decorations`] for details.
///
/// [`Window::set_decorations`]: crate::window::Window::set_decorations
2015-09-21 22:42:05 +10:00
#[inline]
pub fn with_decorations(mut self, decorations: bool) -> Self {
2015-09-21 21:15:43 +10:00
self.window.decorations = decorations;
self
}
/// Sets whether or not the window will always be on top of other windows.
///
/// See [`Window::set_always_on_top`] for details.
///
/// [`Window::set_always_on_top`]: crate::window::Window::set_always_on_top
#[inline]
pub fn with_always_on_top(mut self, always_on_top: bool) -> Self {
self.window.always_on_top = always_on_top;
self
}
/// Sets the window icon.
2018-05-08 07:36:21 +10:00
///
/// See [`Window::set_window_icon`] for details.
2018-05-08 07:36:21 +10:00
///
/// [`Window::set_window_icon`]: crate::window::Window::set_window_icon
2018-05-08 07:36:21 +10:00
#[inline]
pub fn with_window_icon(mut self, window_icon: Option<Icon>) -> Self {
2018-05-08 07:36:21 +10:00
self.window.window_icon = window_icon;
self
}
/// Builds the window.
///
2019-06-22 09:35:08 +10:00
/// Possible causes of error include denied permission, incompatible system, and lack of memory.
///
/// Platform-specific behavior:
/// - **Web**: The window is created but not inserted into the web page automatically. Please
/// see the web platform module for more information.
2018-06-15 09:42:18 +10:00
#[inline]
pub fn build<T: 'static>(
2019-07-07 03:28:50 +10:00
self,
window_target: &EventLoopWindowTarget<T>,
) -> Result<Window, OsError> {
platform_impl::Window::new(&window_target.p, self.window, self.platform_specific).map(
|window| {
window.request_redraw();
Window { window }
},
)
}
}
/// Base Window functions.
impl Window {
2017-05-11 10:10:07 +10:00
/// Creates a new Window for platforms where this is appropriate.
///
/// This function is equivalent to [`WindowBuilder::new().build(event_loop)`].
///
/// Error should be very rare and only occur in case of permission denied, incompatible system,
/// out of memory, etc.
///
/// Platform-specific behavior:
/// - **Web**: The window is created but not inserted into the web page automatically. Please
/// see the web platform module for more information.
2019-10-17 07:09:39 +11:00
///
/// [`WindowBuilder::new().build(event_loop)`]: crate::window::WindowBuilder::build
#[inline]
pub fn new<T: 'static>(event_loop: &EventLoopWindowTarget<T>) -> Result<Window, OsError> {
let builder = WindowBuilder::new();
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
builder.build(event_loop)
}
/// Returns an identifier unique to the window.
#[inline]
pub fn id(&self) -> WindowId {
WindowId(self.window.id())
}
/// Returns the scale factor that can be used to map logical pixels to physical pixels, and vice versa.
///
/// See the [`dpi`](crate::dpi) module for more information.
///
/// Note that this value can change depending on user action (for example if the window is
2020-01-06 08:57:32 +11:00
/// moved to another screen); as such, tracking `WindowEvent::ScaleFactorChanged` events is
/// the most robust way to track the DPI you need to use to draw.
///
/// ## Platform-specific
///
/// - **X11:** This respects Xft.dpi, and can be overridden using the `WINIT_X11_SCALE_FACTOR` environment variable.
/// - **Android:** Always returns 1.0.
/// - **iOS:** Can only be called on the main thread. Returns the underlying `UIView`'s
/// [`contentScaleFactor`].
///
/// [`contentScaleFactor`]: https://developer.apple.com/documentation/uikit/uiview/1622657-contentscalefactor?language=objc
#[inline]
pub fn scale_factor(&self) -> f64 {
self.window.scale_factor()
}
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
/// Emits a `WindowEvent::RedrawRequested` event in the associated event loop after all OS
/// events have been processed by the event loop.
///
2019-06-18 08:22:01 +10:00
/// This is the **strongly encouraged** method of redrawing windows, as it can integrate with
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
/// OS-requested redraws (e.g. when a window gets resized).
///
/// This function can cause `RedrawRequested` events to be emitted after `Event::MainEventsCleared`
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
/// but before `Event::NewEvents` if called in the following circumstances:
/// * While processing `MainEventsCleared`.
/// * While processing a `RedrawRequested` event that was sent during `MainEventsCleared` or any
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
/// directly subsequent `RedrawRequested` event.
///
/// ## Platform-specific
///
/// - **iOS:** Can only be called on the main thread.
/// - **Android:** Unsupported.
#[inline]
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
pub fn request_redraw(&self) {
self.window.request_redraw()
}
}
/// Position and size functions.
impl Window {
/// Returns the position of the top-left hand corner of the window's client area relative to the
/// top-left hand corner of the desktop.
///
/// The same conditions that apply to `outer_position` apply to this method.
///
/// ## Platform-specific
///
/// - **iOS:** Can only be called on the main thread. Returns the top left coordinates of the
/// window's [safe area] in the screen space coordinate system.
/// - **Web:** Returns the top-left coordinates relative to the viewport. _Note: this returns the
/// same value as `outer_position`._
/// - **Android / Wayland:** Always returns [`NotSupportedError`].
///
/// [safe area]: https://developer.apple.com/documentation/uikit/uiview/2891103-safeareainsets?language=objc
#[inline]
pub fn inner_position(&self) -> Result<PhysicalPosition<i32>, NotSupportedError> {
self.window.inner_position()
}
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
/// Returns the position of the top-left hand corner of the window relative to the
/// top-left hand corner of the desktop.
///
2015-03-26 14:44:21 +11:00
/// Note that the top-left hand corner of the desktop is not necessarily the same as
/// the screen. If the user uses a desktop with multiple monitors, the top-left hand corner
/// of the desktop is the top-left hand corner of the monitor at the top-left of the desktop.
///
/// The coordinates can be negative if the top-left hand corner of the window is outside
/// of the visible screen region.
///
/// ## Platform-specific
///
/// - **iOS:** Can only be called on the main thread. Returns the top left coordinates of the
/// window in the screen space coordinate system.
/// - **Web:** Returns the top-left coordinates relative to the viewport.
/// - **Android / Wayland:** Always returns [`NotSupportedError`].
#[inline]
pub fn outer_position(&self) -> Result<PhysicalPosition<i32>, NotSupportedError> {
self.window.outer_position()
}
/// Modifies the position of the window.
///
/// See `outer_position` for more information about the coordinates. This automatically un-maximizes the
/// window if it's maximized.
///
/// ## Platform-specific
///
/// - **iOS:** Can only be called on the main thread. Sets the top left coordinates of the
/// window in the screen space coordinate system.
/// - **Web:** Sets the top-left coordinates relative to the viewport.
/// - **Android / Wayland:** Unsupported.
#[inline]
pub fn set_outer_position<P: Into<Position>>(&self, position: P) {
self.window.set_outer_position(position.into())
}
/// Returns the physical size of the window's client area.
///
/// The client area is the content of the window, excluding the title bar and borders.
///
/// ## Platform-specific
///
/// - **iOS:** Can only be called on the main thread. Returns the `PhysicalSize` of the window's
/// [safe area] in screen space coordinates.
/// - **Web:** Returns the size of the canvas element.
///
/// [safe area]: https://developer.apple.com/documentation/uikit/uiview/2891103-safeareainsets?language=objc
#[inline]
pub fn inner_size(&self) -> PhysicalSize<u32> {
self.window.inner_size()
}
/// Modifies the inner size of the window.
///
/// See `inner_size` for more information about the values. This automatically un-maximizes the
/// window if it's maximized.
///
/// ## Platform-specific
///
/// - **iOS / Android:** Unsupported.
/// - **Web:** Sets the size of the canvas element.
#[inline]
pub fn set_inner_size<S: Into<Size>>(&self, size: S) {
self.window.set_inner_size(size.into())
}
/// Returns the physical size of the entire window.
///
/// These dimensions include the title bar and borders. If you don't want that (and you usually don't),
/// use `inner_size` instead.
///
/// ## Platform-specific
///
/// - **iOS:** Can only be called on the main thread. Returns the `PhysicalSize` of the window in
/// screen space coordinates.
/// - **Web:** Returns the size of the canvas element. _Note: this returns the same value as
/// `inner_size`._
#[inline]
pub fn outer_size(&self) -> PhysicalSize<u32> {
self.window.outer_size()
}
/// Sets a minimum dimension size for the window.
///
/// ## Platform-specific
///
/// - **iOS / Android / Web:** Unsupported.
#[inline]
pub fn set_min_inner_size<S: Into<Size>>(&self, min_size: Option<S>) {
self.window.set_min_inner_size(min_size.map(|s| s.into()))
}
/// Sets a maximum dimension size for the window.
///
/// ## Platform-specific
///
2021-02-28 07:25:26 +11:00
/// - **iOS / Android / Web:** Unsupported.
#[inline]
pub fn set_max_inner_size<S: Into<Size>>(&self, max_size: Option<S>) {
self.window.set_max_inner_size(max_size.map(|s| s.into()))
}
}
/// Misc. attribute functions.
impl Window {
/// Modifies the title of the window.
///
2018-06-15 09:42:18 +10:00
/// ## Platform-specific
///
/// - **iOS / Android:** Unsupported.
#[inline]
pub fn set_title(&self, title: &str) {
self.window.set_title(title)
}
/// Modifies the window's visibility.
///
/// If `false`, this will hide the window. If `true`, this will show the window.
/// ## Platform-specific
///
/// - **Android / Wayland / Web:** Unsupported.
/// - **iOS:** Can only be called on the main thread.
2018-06-15 09:42:18 +10:00
#[inline]
pub fn set_visible(&self, visible: bool) {
self.window.set_visible(visible)
}
/// Sets whether the window is resizable or not.
///
/// Note that making the window unresizable doesn't exempt you from handling `Resized`, as that event can still be
/// triggered by DPI scaling, entering fullscreen mode, etc.
///
/// ## Platform-specific
///
/// This only has an effect on desktop platforms.
///
/// Due to a bug in XFCE, this has no effect on Xfwm.
///
/// ## Platform-specific
///
/// - **iOS / Android / Web:** Unsupported.
2015-09-21 22:42:05 +10:00
#[inline]
pub fn set_resizable(&self, resizable: bool) {
self.window.set_resizable(resizable)
}
2017-01-29 01:05:36 +11:00
/// Sets the window to minimized or back
///
/// ## Platform-specific
///
/// - **iOS / Android / Web:** Unsupported.
/// - **Wayland:** Un-minimize is unsupported.
#[inline]
pub fn set_minimized(&self, minimized: bool) {
self.window.set_minimized(minimized);
}
/// Sets the window to maximized or back.
///
/// ## Platform-specific
///
/// - **iOS / Android / Web:** Unsupported.
#[inline]
pub fn set_maximized(&self, maximized: bool) {
self.window.set_maximized(maximized)
}
/// Gets the window's current maximized state.
///
/// ## Platform-specific
///
/// - **Wayland / X11:** Not implemented.
/// - **iOS / Android / Web:** Unsupported.
#[inline]
pub fn is_maximized(&self) -> bool {
self.window.is_maximized()
}
/// Sets the window to fullscreen or back.
///
/// ## Platform-specific
///
Add exclusive fullscreen mode (#925) * Add exclusive fullscreen mode * Add `WindowExtMacOS::set_fullscreen_presentation_options` * Capture display for exclusive fullscreen on macOS * Fix applying video mode on macOS after a fullscreen cycle * Fix compilation on iOS * Set monitor appropriately for fullscreen on macOS * Fix exclusive to borderless fullscreen transitions on macOS * Fix borderless to exclusive fullscreen transition on macOS * Sort video modes on Windows * Fix fullscreen issues on Windows * Fix video mode changes during exclusive fullscreen on Windows * Add video mode sorting for macOS and iOS * Fix monitor `ns_screen` returning `None` after video mode change * Fix "multithreaded" example on macOS * Restore video mode upon closing an exclusive fullscreen window * Fix "multithreaded" example closing multiple windows at once * Fix compilation on Linux * Update FEATURES.md * Don't care about logical monitor groups on X11 * Add exclusive fullscreen for X11 * Update FEATURES.md * Fix transitions between exclusive and borderless fullscreen on X11 * Update CHANGELOG.md * Document that Wayland doesn't support exclusive fullscreen * Replace core-graphics display mode bindings on macOS * Use `panic!()` instead of `unreachable!()` in "fullscreen" example * Fix fullscreen "always on top" flag on Windows * Track current monitor for fullscreen in "multithreaded" example * Fix exclusive fullscreen sometimes not positioning window properly * Format * More formatting and fix CI issues * Fix formatting * Fix changelog formatting
2019-07-30 04:16:14 +10:00
/// - **macOS:** `Fullscreen::Exclusive` provides true exclusive mode with a
/// video mode change. *Caveat!* macOS doesn't provide task switching (or
/// spaces!) while in exclusive fullscreen mode. This mode should be used
/// when a video mode change is desired, but for a better user experience,
/// borderless fullscreen might be preferred.
///
/// `Fullscreen::Borderless` provides a borderless fullscreen window on a
/// separate space. This is the idiomatic way for fullscreen games to work
/// on macOS. See `WindowExtMacOs::set_simple_fullscreen` if
Add exclusive fullscreen mode (#925) * Add exclusive fullscreen mode * Add `WindowExtMacOS::set_fullscreen_presentation_options` * Capture display for exclusive fullscreen on macOS * Fix applying video mode on macOS after a fullscreen cycle * Fix compilation on iOS * Set monitor appropriately for fullscreen on macOS * Fix exclusive to borderless fullscreen transitions on macOS * Fix borderless to exclusive fullscreen transition on macOS * Sort video modes on Windows * Fix fullscreen issues on Windows * Fix video mode changes during exclusive fullscreen on Windows * Add video mode sorting for macOS and iOS * Fix monitor `ns_screen` returning `None` after video mode change * Fix "multithreaded" example on macOS * Restore video mode upon closing an exclusive fullscreen window * Fix "multithreaded" example closing multiple windows at once * Fix compilation on Linux * Update FEATURES.md * Don't care about logical monitor groups on X11 * Add exclusive fullscreen for X11 * Update FEATURES.md * Fix transitions between exclusive and borderless fullscreen on X11 * Update CHANGELOG.md * Document that Wayland doesn't support exclusive fullscreen * Replace core-graphics display mode bindings on macOS * Use `panic!()` instead of `unreachable!()` in "fullscreen" example * Fix fullscreen "always on top" flag on Windows * Track current monitor for fullscreen in "multithreaded" example * Fix exclusive fullscreen sometimes not positioning window properly * Format * More formatting and fix CI issues * Fix formatting * Fix changelog formatting
2019-07-30 04:16:14 +10:00
/// separate spaces are not preferred.
///
/// The dock and the menu bar are always disabled in fullscreen mode.
/// - **iOS:** Can only be called on the main thread.
Update SCTK to 0.11.0 * Update SCTK to 0.11.0 Updates smithay-client-toolkit to 0.11.0. The major highlight of that updated, is update of wayland-rs to 0.27.0. Switching to wayland-cursor, instead of using libwayland-cursor. It also fixes the following bugs: - Disabled repeat rate not being handled. - Decoration buttons not working after tty switch. - Scaling not being applied on output reenable. - Crash when `XCURSOR_SIZE` is `0`. - Pointer getting created in some cases without pointer capability. - On kwin, fix space between window and decorations on startup. - Incorrect size event when entering fullscreen when using client side decorations. - Client side decorations not being hided properly in fullscreen. - Size tracking between fullscreen/tiled state changes. - Repeat rate triggering multiple times from slow callback handler. - Resizable attribute not being applied properly on startup. - Not working IME Besides those fixes it also adds a bunch of missing virtual key codes, implements proper cursor grabbing, adds right click on decorations to open application menu, disabled maximize button for non-resizeable window, and fall back for cursor icon to similar ones, if the requested is missing. It also adds new methods to a `Theme` trait, such as: - `title_font(&self) -> Option<(String, f32)>` - The font for a title. - `title_color(&self, window_active: bool) -> [u8; 4]` - The color of the text in the title. Fixes #1680. Fixes #1678. Fixes #1676. Fixes #1646. Fixes #1614. Fixes #1601. Fixes #1533. Fixes #1509. Fixes #952. Fixes #947.
2020-09-29 07:11:43 +10:00
/// - **Wayland:** Does not support exclusive fullscreen mode and will no-op a request.
/// - **Windows:** Screen saver is disabled in fullscreen mode.
/// - **Android:** Unsupported.
#[inline]
Add exclusive fullscreen mode (#925) * Add exclusive fullscreen mode * Add `WindowExtMacOS::set_fullscreen_presentation_options` * Capture display for exclusive fullscreen on macOS * Fix applying video mode on macOS after a fullscreen cycle * Fix compilation on iOS * Set monitor appropriately for fullscreen on macOS * Fix exclusive to borderless fullscreen transitions on macOS * Fix borderless to exclusive fullscreen transition on macOS * Sort video modes on Windows * Fix fullscreen issues on Windows * Fix video mode changes during exclusive fullscreen on Windows * Add video mode sorting for macOS and iOS * Fix monitor `ns_screen` returning `None` after video mode change * Fix "multithreaded" example on macOS * Restore video mode upon closing an exclusive fullscreen window * Fix "multithreaded" example closing multiple windows at once * Fix compilation on Linux * Update FEATURES.md * Don't care about logical monitor groups on X11 * Add exclusive fullscreen for X11 * Update FEATURES.md * Fix transitions between exclusive and borderless fullscreen on X11 * Update CHANGELOG.md * Document that Wayland doesn't support exclusive fullscreen * Replace core-graphics display mode bindings on macOS * Use `panic!()` instead of `unreachable!()` in "fullscreen" example * Fix fullscreen "always on top" flag on Windows * Track current monitor for fullscreen in "multithreaded" example * Fix exclusive fullscreen sometimes not positioning window properly * Format * More formatting and fix CI issues * Fix formatting * Fix changelog formatting
2019-07-30 04:16:14 +10:00
pub fn set_fullscreen(&self, fullscreen: Option<Fullscreen>) {
self.window.set_fullscreen(fullscreen)
Move fullscreen modes to not touch physical resolutions (#270) * Fix X11 screen resolution change using XrandR The previous XF86 resolution switching was broken and everything seems to have moved on to xrandr. Use that instead while cleaning up the code a bit as well. * Use XRandR for actual multiscreen support in X11 * Use actual monitor names in X11 * Get rid of ptr::read usage in X11 * Use a bog standard Vec instead of VecDeque * Get rid of the XRandR mode switching stuff Wayland has made the decision that apps shouldn't change screen resolutions and just take the screens as they've been setup. In the modern world where GPU scaling is cheap and LCD panels are scaling anyway it makes no sense to make "physical" resolution changes when software should be taking care of it. This massively simplifies the code and makes it easier to extend to more niche setups like MST and videowalls. * Rename fullscreen options to match new semantics * Implement XRandR 1.5 support * Get rid of the FullScreen enum Moving to just having two states None and Some(MonitorId) and then being able to set full screen in the current monitor with something like: window.set_fullscreen(Some(window.current_monitor())); * Implement Window::get_current_monitor() Do it by iterating over the available monitors and finding which has the biggest overlap with the window. For this MonitorId needs a new get_position() that needs to be implemented for all platforms. * Add unimplemented get_position() to all MonitorId * Make get_current_monitor() platform specific * Add unimplemented get_current_monitor() to all * Implement proper primary monitor selection in X11 * Shut up some warnings * Remove libxxf86vm package from travis Since we're no longer using XF86 there's no need to keep the package around for CI. * Don't use new struct syntax * Fix indentation * Adjust Android/iOS fullscreen/maximized On Android and iOS we can assume single screen apps that are already fullscreen and maximized so there are a few methods that are implemented by just returning a fixed value or not doing anything. * Mark OSX/Win fullscreen/maximized unimplemented()! These would be safe as no-ops but we should make it explicit so there is more of an incentive to actually implement them.
2017-09-07 18:33:46 +10:00
}
/// Gets the window's current fullscreen state.
///
/// ## Platform-specific
///
/// - **iOS:** Can only be called on the main thread.
/// - **Android:** Will always return `None`.
/// - **Wayland:** Can return `Borderless(None)` when there are no monitors.
#[inline]
Add exclusive fullscreen mode (#925) * Add exclusive fullscreen mode * Add `WindowExtMacOS::set_fullscreen_presentation_options` * Capture display for exclusive fullscreen on macOS * Fix applying video mode on macOS after a fullscreen cycle * Fix compilation on iOS * Set monitor appropriately for fullscreen on macOS * Fix exclusive to borderless fullscreen transitions on macOS * Fix borderless to exclusive fullscreen transition on macOS * Sort video modes on Windows * Fix fullscreen issues on Windows * Fix video mode changes during exclusive fullscreen on Windows * Add video mode sorting for macOS and iOS * Fix monitor `ns_screen` returning `None` after video mode change * Fix "multithreaded" example on macOS * Restore video mode upon closing an exclusive fullscreen window * Fix "multithreaded" example closing multiple windows at once * Fix compilation on Linux * Update FEATURES.md * Don't care about logical monitor groups on X11 * Add exclusive fullscreen for X11 * Update FEATURES.md * Fix transitions between exclusive and borderless fullscreen on X11 * Update CHANGELOG.md * Document that Wayland doesn't support exclusive fullscreen * Replace core-graphics display mode bindings on macOS * Use `panic!()` instead of `unreachable!()` in "fullscreen" example * Fix fullscreen "always on top" flag on Windows * Track current monitor for fullscreen in "multithreaded" example * Fix exclusive fullscreen sometimes not positioning window properly * Format * More formatting and fix CI issues * Fix formatting * Fix changelog formatting
2019-07-30 04:16:14 +10:00
pub fn fullscreen(&self) -> Option<Fullscreen> {
self.window.fullscreen()
}
/// Turn window decorations on or off.
///
/// ## Platform-specific
///
/// - **iOS / Android / Web:** Unsupported.
///
/// [`setPrefersStatusBarHidden`]: https://developer.apple.com/documentation/uikit/uiviewcontroller/1621440-prefersstatusbarhidden?language=objc
#[inline]
pub fn set_decorations(&self, decorations: bool) {
self.window.set_decorations(decorations)
}
/// Change whether or not the window will always be on top of other windows.
///
/// ## Platform-specific
///
/// - **iOS / Android / Web / Wayland:** Unsupported.
#[inline]
pub fn set_always_on_top(&self, always_on_top: bool) {
self.window.set_always_on_top(always_on_top)
}
2018-05-08 07:36:21 +10:00
/// Sets the window icon. On Windows and X11, this is typically the small icon in the top-left
/// corner of the titlebar.
///
/// ## Platform-specific
///
/// - **iOS / Android / Web / Wayland / macOS:** Unsupported.
///
/// On Windows, this sets `ICON_SMALL`. The base size for a window icon is 16x16, but it's
/// recommended to account for screen scaling and pick a multiple of that, i.e. 32x32.
///
/// X11 has no universal guidelines for icon sizes, so you're at the whims of the WM. That
/// said, it's usually in the same ballpark as on Windows.
2018-05-08 07:36:21 +10:00
#[inline]
pub fn set_window_icon(&self, window_icon: Option<Icon>) {
self.window.set_window_icon(window_icon)
}
/// Sets location of IME candidate box in client area coordinates relative to the top left.
///
/// ## Platform-specific
///
/// - **iOS / Android / Web:** Unsupported.
#[inline]
pub fn set_ime_position<P: Into<Position>>(&self, position: P) {
self.window.set_ime_position(position.into())
}
/// Requests user attention to the window, this has no effect if the application
/// is already focused. How requesting for user attention manifests is platform dependent,
/// see `UserAttentionType` for details.
///
/// Providing `None` will unset the request for user attention. Unsetting the request for
/// user attention might not be done automatically by the WM when the window receives input.
///
/// ## Platform-specific
///
/// - **iOS / Android / Web / Wayland:** Unsupported.
/// - **macOS:** `None` has no effect.
/// - **X11:** Requests for user attention must be manually cleared.
#[inline]
pub fn request_user_attention(&self, request_type: Option<UserAttentionType>) {
self.window.request_user_attention(request_type)
}
}
/// Cursor functions.
impl Window {
/// Modifies the cursor icon of the window.
///
/// ## Platform-specific
///
/// - **iOS / Android:** Unsupported.
2018-06-15 09:42:18 +10:00
#[inline]
pub fn set_cursor_icon(&self, cursor: CursorIcon) {
self.window.set_cursor_icon(cursor);
}
/// Changes the position of the cursor in window coordinates.
///
/// ## Platform-specific
///
/// - **iOS / Android / Web / Wayland:** Always returns an [`ExternalError::NotSupported`].
#[inline]
pub fn set_cursor_position<P: Into<Position>>(&self, position: P) -> Result<(), ExternalError> {
self.window.set_cursor_position(position.into())
}
/// Grabs the cursor, preventing it from leaving the window.
///
Update SCTK to 0.11.0 * Update SCTK to 0.11.0 Updates smithay-client-toolkit to 0.11.0. The major highlight of that updated, is update of wayland-rs to 0.27.0. Switching to wayland-cursor, instead of using libwayland-cursor. It also fixes the following bugs: - Disabled repeat rate not being handled. - Decoration buttons not working after tty switch. - Scaling not being applied on output reenable. - Crash when `XCURSOR_SIZE` is `0`. - Pointer getting created in some cases without pointer capability. - On kwin, fix space between window and decorations on startup. - Incorrect size event when entering fullscreen when using client side decorations. - Client side decorations not being hided properly in fullscreen. - Size tracking between fullscreen/tiled state changes. - Repeat rate triggering multiple times from slow callback handler. - Resizable attribute not being applied properly on startup. - Not working IME Besides those fixes it also adds a bunch of missing virtual key codes, implements proper cursor grabbing, adds right click on decorations to open application menu, disabled maximize button for non-resizeable window, and fall back for cursor icon to similar ones, if the requested is missing. It also adds new methods to a `Theme` trait, such as: - `title_font(&self) -> Option<(String, f32)>` - The font for a title. - `title_color(&self, window_active: bool) -> [u8; 4]` - The color of the text in the title. Fixes #1680. Fixes #1678. Fixes #1676. Fixes #1646. Fixes #1614. Fixes #1601. Fixes #1533. Fixes #1509. Fixes #952. Fixes #947.
2020-09-29 07:11:43 +10:00
/// There's no guarantee that the cursor will be hidden. You should
/// hide it by yourself if you want so.
///
/// ## Platform-specific
///
Update SCTK to 0.11.0 * Update SCTK to 0.11.0 Updates smithay-client-toolkit to 0.11.0. The major highlight of that updated, is update of wayland-rs to 0.27.0. Switching to wayland-cursor, instead of using libwayland-cursor. It also fixes the following bugs: - Disabled repeat rate not being handled. - Decoration buttons not working after tty switch. - Scaling not being applied on output reenable. - Crash when `XCURSOR_SIZE` is `0`. - Pointer getting created in some cases without pointer capability. - On kwin, fix space between window and decorations on startup. - Incorrect size event when entering fullscreen when using client side decorations. - Client side decorations not being hided properly in fullscreen. - Size tracking between fullscreen/tiled state changes. - Repeat rate triggering multiple times from slow callback handler. - Resizable attribute not being applied properly on startup. - Not working IME Besides those fixes it also adds a bunch of missing virtual key codes, implements proper cursor grabbing, adds right click on decorations to open application menu, disabled maximize button for non-resizeable window, and fall back for cursor icon to similar ones, if the requested is missing. It also adds new methods to a `Theme` trait, such as: - `title_font(&self) -> Option<(String, f32)>` - The font for a title. - `title_color(&self, window_active: bool) -> [u8; 4]` - The color of the text in the title. Fixes #1680. Fixes #1678. Fixes #1676. Fixes #1646. Fixes #1614. Fixes #1601. Fixes #1533. Fixes #1509. Fixes #952. Fixes #947.
2020-09-29 07:11:43 +10:00
/// - **macOS:** This locks the cursor in a fixed location, which looks visually awkward.
/// - **iOS / Android / Web:** Always returns an [`ExternalError::NotSupported`].
#[inline]
pub fn set_cursor_grab(&self, grab: bool) -> Result<(), ExternalError> {
self.window.set_cursor_grab(grab)
}
/// Modifies the cursor's visibility.
///
/// If `false`, this will hide the cursor. If `true`, this will show the cursor.
///
/// ## Platform-specific
///
/// - **Windows:** The cursor is only hidden within the confines of the window.
/// - **X11:** The cursor is only hidden within the confines of the window.
/// - **Wayland:** The cursor is only hidden within the confines of the window.
/// - **macOS:** The cursor is hidden as long as the window has input focus, even if the cursor is
/// outside of the window.
/// - **iOS / Android:** Unsupported.
2017-01-29 01:05:36 +11:00
#[inline]
pub fn set_cursor_visible(&self, visible: bool) {
self.window.set_cursor_visible(visible)
2017-01-29 01:05:36 +11:00
}
/// Moves the window with the left mouse button until the button is released.
///
/// There's no guarantee that this will work unless the left mouse button was pressed
/// immediately before this function is called.
///
/// ## Platform-specific
///
/// - **X11:** Un-grabs the cursor.
/// - **Wayland:** Requires the cursor to be inside the window to be dragged.
/// - **macOS:** May prevent the button release event to be triggered.
/// - **iOS / Android / Web:** Always returns an [`ExternalError::NotSupported`].
#[inline]
pub fn drag_window(&self) -> Result<(), ExternalError> {
self.window.drag_window()
}
}
/// Monitor info functions.
impl Window {
/// Returns the monitor on which the window currently resides.
///
/// Returns `None` if current monitor can't be detected.
///
/// ## Platform-specific
///
/// **iOS:** Can only be called on the main thread.
#[inline]
pub fn current_monitor(&self) -> Option<MonitorHandle> {
self.window.current_monitor()
}
/// Returns the list of all the monitors available on the system.
///
/// This is the same as `EventLoopWindowTarget::available_monitors`, and is provided for convenience.
///
/// ## Platform-specific
///
/// **iOS:** Can only be called on the main thread.
#[inline]
pub fn available_monitors(&self) -> impl Iterator<Item = MonitorHandle> {
self.window
.available_monitors()
.into_iter()
.map(|inner| MonitorHandle { inner })
}
/// Returns the primary monitor of the system.
///
/// Returns `None` if it can't identify any monitor as a primary one.
///
/// This is the same as `EventLoopWindowTarget::primary_monitor`, and is provided for convenience.
///
/// ## Platform-specific
///
/// **iOS:** Can only be called on the main thread.
/// **Wayland:** Always returns `None`.
#[inline]
pub fn primary_monitor(&self) -> Option<MonitorHandle> {
self.window.primary_monitor()
}
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
}
Move fullscreen modes to not touch physical resolutions (#270) * Fix X11 screen resolution change using XrandR The previous XF86 resolution switching was broken and everything seems to have moved on to xrandr. Use that instead while cleaning up the code a bit as well. * Use XRandR for actual multiscreen support in X11 * Use actual monitor names in X11 * Get rid of ptr::read usage in X11 * Use a bog standard Vec instead of VecDeque * Get rid of the XRandR mode switching stuff Wayland has made the decision that apps shouldn't change screen resolutions and just take the screens as they've been setup. In the modern world where GPU scaling is cheap and LCD panels are scaling anyway it makes no sense to make "physical" resolution changes when software should be taking care of it. This massively simplifies the code and makes it easier to extend to more niche setups like MST and videowalls. * Rename fullscreen options to match new semantics * Implement XRandR 1.5 support * Get rid of the FullScreen enum Moving to just having two states None and Some(MonitorId) and then being able to set full screen in the current monitor with something like: window.set_fullscreen(Some(window.current_monitor())); * Implement Window::get_current_monitor() Do it by iterating over the available monitors and finding which has the biggest overlap with the window. For this MonitorId needs a new get_position() that needs to be implemented for all platforms. * Add unimplemented get_position() to all MonitorId * Make get_current_monitor() platform specific * Add unimplemented get_current_monitor() to all * Implement proper primary monitor selection in X11 * Shut up some warnings * Remove libxxf86vm package from travis Since we're no longer using XF86 there's no need to keep the package around for CI. * Don't use new struct syntax * Fix indentation * Adjust Android/iOS fullscreen/maximized On Android and iOS we can assume single screen apps that are already fullscreen and maximized so there are a few methods that are implemented by just returning a fixed value or not doing anything. * Mark OSX/Win fullscreen/maximized unimplemented()! These would be safe as no-ops but we should make it explicit so there is more of an incentive to actually implement them.
2017-09-07 18:33:46 +10:00
unsafe impl raw_window_handle::HasRawWindowHandle for Window {
/// Returns a `raw_window_handle::RawWindowHandle` for the Window
///
/// ## Platform-specific
///
/// - **Android:** Only available after receiving the Resumed event and before Suspended. *If you*
/// *try to get the handle outside of that period, this function will panic*!
fn raw_window_handle(&self) -> raw_window_handle::RawWindowHandle {
self.window.raw_window_handle()
}
}
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
/// Describes the appearance of the mouse cursor.
#[derive(Debug, Copy, Clone, PartialEq, Eq, Hash)]
#[cfg_attr(feature = "serde", derive(Serialize, Deserialize))]
pub enum CursorIcon {
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
/// The platform-dependent default cursor.
Default,
/// A simple crosshair.
Crosshair,
/// A hand (often used to indicate links in web browsers).
Hand,
/// Self explanatory.
Arrow,
/// Indicates something is to be moved.
Move,
/// Indicates text that may be selected or edited.
Text,
/// Program busy indicator.
Wait,
/// Help indicator (often rendered as a "?")
Help,
/// Progress indicator. Shows that processing is being done. But in contrast
/// with "Wait" the user may still interact with the program. Often rendered
/// as a spinning beach ball, or an arrow with a watch or hourglass.
Progress,
/// Cursor showing that something cannot be done.
NotAllowed,
ContextMenu,
Cell,
VerticalText,
Alias,
Copy,
NoDrop,
/// Indicates something can be grabbed.
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
Grab,
/// Indicates something is grabbed.
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
Grabbing,
AllScroll,
ZoomIn,
ZoomOut,
/// Indicate that some edge is to be moved. For example, the 'SeResize' cursor
/// is used when the movement starts from the south-east corner of the box.
EResize,
NResize,
NeResize,
NwResize,
SResize,
SeResize,
SwResize,
WResize,
EwResize,
NsResize,
NeswResize,
NwseResize,
ColResize,
RowResize,
}
impl Default for CursorIcon {
Event Loop 2.0 API and Windows implementation (#638) * Rename EventsLoop and associated types to EventLoop * Rename WindowEvent::Refresh to WindowEvent::Redraw * Remove second thread from win32 backend * Update run_forever to hijack thread * Replace windows Mutex with parking_lot Mutex * Implement new ControlFlow and associated events * Add StartCause::Init support, timer example * Add ability to send custom user events * Fully invert windows control flow so win32 calls into winit's callback * Add request_redraw * Rename platform to platform_impl * Rename os to platform, add Ext trait postfixes * Add platform::desktop module with EventLoopExt::run_return * Re-organize into module structure * Improve documentation * Small changes to examples * Improve docs for run and run_return * Change instances of "events_loop" to "event_loop" * Rename MonitorId to MonitorHandle * Add CHANGELOG entry * Improve WaitUntil timer precision * When SendEvent is called during event closure, buffer events * Fix resize lag when waiting in some situations * Update send test and errors that broke some examples/APIs * Improve clarity/fix typos in docs * Fix unreachable panic after setting ControlFlow to Poll during some RedrawRequested events. * Fix crash when running in release mode * Remove crossbeam dependency and make drop events work again * Remove serde implementations from ControlFlow * Fix 1.24.1 build * Fix freeze when setting decorations * Replace &EventLoop in callback with &EventLoopWindowTarget * Document and implement Debug for EventLoopWindowTarget * Fix some deadlocks that could occur when changing window state * Fix thread executor not executing closure when called from non-loop thread * Fix buffered events not getting dispatched * Fix crash with runner refcell not getting dropped * Address review feedback * Fix CHANGELOG typo * Catch panics in user callback
2019-02-06 02:30:33 +11:00
fn default() -> Self {
CursorIcon::Default
}
}
Add exclusive fullscreen mode (#925) * Add exclusive fullscreen mode * Add `WindowExtMacOS::set_fullscreen_presentation_options` * Capture display for exclusive fullscreen on macOS * Fix applying video mode on macOS after a fullscreen cycle * Fix compilation on iOS * Set monitor appropriately for fullscreen on macOS * Fix exclusive to borderless fullscreen transitions on macOS * Fix borderless to exclusive fullscreen transition on macOS * Sort video modes on Windows * Fix fullscreen issues on Windows * Fix video mode changes during exclusive fullscreen on Windows * Add video mode sorting for macOS and iOS * Fix monitor `ns_screen` returning `None` after video mode change * Fix "multithreaded" example on macOS * Restore video mode upon closing an exclusive fullscreen window * Fix "multithreaded" example closing multiple windows at once * Fix compilation on Linux * Update FEATURES.md * Don't care about logical monitor groups on X11 * Add exclusive fullscreen for X11 * Update FEATURES.md * Fix transitions between exclusive and borderless fullscreen on X11 * Update CHANGELOG.md * Document that Wayland doesn't support exclusive fullscreen * Replace core-graphics display mode bindings on macOS * Use `panic!()` instead of `unreachable!()` in "fullscreen" example * Fix fullscreen "always on top" flag on Windows * Track current monitor for fullscreen in "multithreaded" example * Fix exclusive fullscreen sometimes not positioning window properly * Format * More formatting and fix CI issues * Fix formatting * Fix changelog formatting
2019-07-30 04:16:14 +10:00
/// Fullscreen modes.
Add exclusive fullscreen mode (#925) * Add exclusive fullscreen mode * Add `WindowExtMacOS::set_fullscreen_presentation_options` * Capture display for exclusive fullscreen on macOS * Fix applying video mode on macOS after a fullscreen cycle * Fix compilation on iOS * Set monitor appropriately for fullscreen on macOS * Fix exclusive to borderless fullscreen transitions on macOS * Fix borderless to exclusive fullscreen transition on macOS * Sort video modes on Windows * Fix fullscreen issues on Windows * Fix video mode changes during exclusive fullscreen on Windows * Add video mode sorting for macOS and iOS * Fix monitor `ns_screen` returning `None` after video mode change * Fix "multithreaded" example on macOS * Restore video mode upon closing an exclusive fullscreen window * Fix "multithreaded" example closing multiple windows at once * Fix compilation on Linux * Update FEATURES.md * Don't care about logical monitor groups on X11 * Add exclusive fullscreen for X11 * Update FEATURES.md * Fix transitions between exclusive and borderless fullscreen on X11 * Update CHANGELOG.md * Document that Wayland doesn't support exclusive fullscreen * Replace core-graphics display mode bindings on macOS * Use `panic!()` instead of `unreachable!()` in "fullscreen" example * Fix fullscreen "always on top" flag on Windows * Track current monitor for fullscreen in "multithreaded" example * Fix exclusive fullscreen sometimes not positioning window properly * Format * More formatting and fix CI issues * Fix formatting * Fix changelog formatting
2019-07-30 04:16:14 +10:00
#[derive(Clone, Debug, PartialEq)]
pub enum Fullscreen {
Exclusive(VideoMode),
/// Providing `None` to `Borderless` will fullscreen on the current monitor.
Borderless(Option<MonitorHandle>),
Add exclusive fullscreen mode (#925) * Add exclusive fullscreen mode * Add `WindowExtMacOS::set_fullscreen_presentation_options` * Capture display for exclusive fullscreen on macOS * Fix applying video mode on macOS after a fullscreen cycle * Fix compilation on iOS * Set monitor appropriately for fullscreen on macOS * Fix exclusive to borderless fullscreen transitions on macOS * Fix borderless to exclusive fullscreen transition on macOS * Sort video modes on Windows * Fix fullscreen issues on Windows * Fix video mode changes during exclusive fullscreen on Windows * Add video mode sorting for macOS and iOS * Fix monitor `ns_screen` returning `None` after video mode change * Fix "multithreaded" example on macOS * Restore video mode upon closing an exclusive fullscreen window * Fix "multithreaded" example closing multiple windows at once * Fix compilation on Linux * Update FEATURES.md * Don't care about logical monitor groups on X11 * Add exclusive fullscreen for X11 * Update FEATURES.md * Fix transitions between exclusive and borderless fullscreen on X11 * Update CHANGELOG.md * Document that Wayland doesn't support exclusive fullscreen * Replace core-graphics display mode bindings on macOS * Use `panic!()` instead of `unreachable!()` in "fullscreen" example * Fix fullscreen "always on top" flag on Windows * Track current monitor for fullscreen in "multithreaded" example * Fix exclusive fullscreen sometimes not positioning window properly * Format * More formatting and fix CI issues * Fix formatting * Fix changelog formatting
2019-07-30 04:16:14 +10:00
}
#[derive(Clone, Copy, Debug, PartialEq)]
pub enum Theme {
Light,
Dark,
}
/// ## Platform-specific
///
/// - **X11:** Sets the WM's `XUrgencyHint`. No distinction between `Critical` and `Informational`.
#[derive(Debug, Clone, Copy, PartialEq)]
pub enum UserAttentionType {
/// ## Platform-specific
/// - **macOS:** Bounces the dock icon until the application is in focus.
/// - **Windows:** Flashes both the window and the taskbar button until the application is in focus.
Critical,
/// ## Platform-specific
/// - **macOS:** Bounces the dock icon once.
/// - **Windows:** Flashes the taskbar button until the application is in focus.
Informational,
}
impl Default for UserAttentionType {
fn default() -> Self {
UserAttentionType::Informational
}
}